Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Triisopropylsilane, 98%
CAS: 6485-79-6 Molecular Formula: C9H22Si Molecular Weight (g/mol): 158.36 MDL Number: MFCD00009657 InChI Key: YDJXDYKQMRNUSA-UHFFFAOYSA-N Synonym: triisopropylsilane,tris propan-2-yl silane,triisopropyl silane,tri propan-2-yl silicon,tri-isopropylsilyl radical,triisopropylsilyl,tri-iso-propylsilane,ambotzrl-1102,pubchem12855 PubChem CID: 6327611 SMILES: CC(C)[SiH](C(C)C)C(C)C
| PubChem CID | 6327611 |
|---|---|
| CAS | 6485-79-6 |
| Molecular Weight (g/mol) | 158.36 |
| MDL Number | MFCD00009657 |
| SMILES | CC(C)[SiH](C(C)C)C(C)C |
| Synonym | triisopropylsilane,tris propan-2-yl silane,triisopropyl silane,tri propan-2-yl silicon,tri-isopropylsilyl radical,triisopropylsilyl,tri-iso-propylsilane,ambotzrl-1102,pubchem12855 |
| InChI Key | YDJXDYKQMRNUSA-UHFFFAOYSA-N |
| Molecular Formula | C9H22Si |
1,4-Bis(trimethylsilyl)-1,3-butadiyne, 98%
CAS: 4526-07-2 Molecular Formula: C10H18Si2 Molecular Weight (g/mol): 194.42 MDL Number: MFCD00009839 InChI Key: LBNVCJHJRYJVPK-UHFFFAOYSA-N SMILES: C[Si](C)(C)C#CC#C[Si](C)(C)C
| CAS | 4526-07-2 |
|---|---|
| Molecular Weight (g/mol) | 194.42 |
| MDL Number | MFCD00009839 |
| SMILES | C[Si](C)(C)C#CC#C[Si](C)(C)C |
| InChI Key | LBNVCJHJRYJVPK-UHFFFAOYSA-N |
| Molecular Formula | C10H18Si2 |
(Propargyloxy)trimethylsilane, 97%
CAS: 5582-62-7 Molecular Formula: C6H12OSi Molecular Weight (g/mol): 128.246 MDL Number: MFCD00042844 InChI Key: ZZRPJWCNCLSOLR-UHFFFAOYSA-N Synonym: propargyloxytrimethylsilane,propargyloxy trimethylsilane,o-trimethylsilylpropargyl alcohol,silane, trimethyl 2-propynyloxy,trimethyl prop-2-yn-1-yloxy silane,3-trimethylsiloxy-1-propyne,trimethyl 2-propynyloxy silane,silane, trimethyl 2-propyn-1-yloxy,trimethyl prop-2-ynyloxy silane,3-trimethylsiloxypropyne PubChem CID: 79696 IUPAC Name: trimethyl(prop-2-ynoxy)silane SMILES: C[Si](C)(C)OCC#C
| PubChem CID | 79696 |
|---|---|
| CAS | 5582-62-7 |
| Molecular Weight (g/mol) | 128.246 |
| MDL Number | MFCD00042844 |
| SMILES | C[Si](C)(C)OCC#C |
| Synonym | propargyloxytrimethylsilane,propargyloxy trimethylsilane,o-trimethylsilylpropargyl alcohol,silane, trimethyl 2-propynyloxy,trimethyl prop-2-yn-1-yloxy silane,3-trimethylsiloxy-1-propyne,trimethyl 2-propynyloxy silane,silane, trimethyl 2-propyn-1-yloxy,trimethyl prop-2-ynyloxy silane,3-trimethylsiloxypropyne |
| IUPAC Name | trimethyl(prop-2-ynoxy)silane |
| InChI Key | ZZRPJWCNCLSOLR-UHFFFAOYSA-N |
| Molecular Formula | C6H12OSi |
Thermo Scientific Chemicals Potassium chloride, 99%, Molecular Biology Grade
CAS: 7447-40-7 Molecular Formula: ClK Molecular Weight (g/mol): 74.55 MDL Number: MFCD00011360 InChI Key: WCUXLLCKKVVCTQ-UHFFFAOYSA-M Synonym: potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs PubChem CID: 4873 ChEBI: CHEBI:32588 SMILES: [Cl-].[K+]
| PubChem CID | 4873 |
|---|---|
| CAS | 7447-40-7 |
| Molecular Weight (g/mol) | 74.55 |
| ChEBI | CHEBI:32588 |
| MDL Number | MFCD00011360 |
| SMILES | [Cl-].[K+] |
| Synonym | potassium chloride,enseal,muriate of potash,klotrix,sylvite,slow-k,potassium chloride kcl,klor-con,chlorvescent,kalitabs |
| InChI Key | WCUXLLCKKVVCTQ-UHFFFAOYSA-M |
| Molecular Formula | ClK |
Tetramethyldisilazane, 97%
CAS: 15933-59-2 Molecular Formula: C4H13NSi2 Molecular Weight (g/mol): 131.325 MDL Number: MFCD00025626 InChI Key: GJWAPAVRQYYSTK-UHFFFAOYSA-N Synonym: 1,1,3,3-tetramethyldisilazane,bis dimethylsilyl amine,tetramethyldisilazane,tetramethyl disilazane,tmds,silanamine, n-dimethylsilyl-1,1-dimethyl,disilazane, 1,1,3,3-tetramethyl,c4h15nsi2,n-dimethylsilyl-1,1-dimethylsilylamine,1,3,3-tetramethyldisilazane PubChem CID: 6327317 IUPAC Name: [(dimethyl-$l^{3}-silanyl)amino]-dimethylsilicon SMILES: C[Si](C)N[Si](C)C
| PubChem CID | 6327317 |
|---|---|
| CAS | 15933-59-2 |
| Molecular Weight (g/mol) | 131.325 |
| MDL Number | MFCD00025626 |
| SMILES | C[Si](C)N[Si](C)C |
| Synonym | 1,1,3,3-tetramethyldisilazane,bis dimethylsilyl amine,tetramethyldisilazane,tetramethyl disilazane,tmds,silanamine, n-dimethylsilyl-1,1-dimethyl,disilazane, 1,1,3,3-tetramethyl,c4h15nsi2,n-dimethylsilyl-1,1-dimethylsilylamine,1,3,3-tetramethyldisilazane |
| IUPAC Name | [(dimethyl-$l^{3}-silanyl)amino]-dimethylsilicon |
| InChI Key | GJWAPAVRQYYSTK-UHFFFAOYSA-N |
| Molecular Formula | C4H13NSi2 |
(Pentafluoroethyl)trimethylsilane, 97%
CAS: 124898-13-1 Molecular Formula: C5H9F5Si Molecular Weight (g/mol): 192.204 MDL Number: MFCD04116436 InChI Key: MTPVUVINMAGMJL-UHFFFAOYSA-N Synonym: pentafluoroethyl trimethylsilane,trimethyl pentafluoroethyl silane,pentafluoroethyltrimethylsilane,trimethylpentafluoroethylsilane,trimethyl perfluoroethyl silane,trimethyl 1,1,2,2,2-pentafluoroethyl silane,silane, trimethyl pentafluoroethyl,silane,trimethyl 1,1,2,2,2-pentafluoroethyl,acmc-20aple,trimethylsilylpentafluoroethane PubChem CID: 2760820 IUPAC Name: trimethyl(1,1,2,2,2-pentafluoroethyl)silane SMILES: C[Si](C)(C)C(C(F)(F)F)(F)F
| PubChem CID | 2760820 |
|---|---|
| CAS | 124898-13-1 |
| Molecular Weight (g/mol) | 192.204 |
| MDL Number | MFCD04116436 |
| SMILES | C[Si](C)(C)C(C(F)(F)F)(F)F |
| Synonym | pentafluoroethyl trimethylsilane,trimethyl pentafluoroethyl silane,pentafluoroethyltrimethylsilane,trimethylpentafluoroethylsilane,trimethyl perfluoroethyl silane,trimethyl 1,1,2,2,2-pentafluoroethyl silane,silane, trimethyl pentafluoroethyl,silane,trimethyl 1,1,2,2,2-pentafluoroethyl,acmc-20aple,trimethylsilylpentafluoroethane |
| IUPAC Name | trimethyl(1,1,2,2,2-pentafluoroethyl)silane |
| InChI Key | MTPVUVINMAGMJL-UHFFFAOYSA-N |
| Molecular Formula | C5H9F5Si |
(3-Isocyanatopropyl)triethoxysilane, 95%
CAS: 24801-88-5 Molecular Formula: C10H21NO4Si Molecular Weight (g/mol): 247.366 MDL Number: MFCD00051459 InChI Key: FRGPKMWIYVTFIQ-UHFFFAOYSA-N Synonym: 3-isocyanatopropyltriethoxysilane,triethoxy 3-isocyanatopropyl silane,3-isocyanatopropyl triethoxysilane,isocyanatopropyltriethoxysilane,3-triethoxysilyl propyl isocyanate,silane, triethoxy 3-isocyanatopropyl,unii-9br6002p6e,isocyanic acid, 3-triethoxysilyl propylester,isocyanic acid, 3-triethoxysilyl propyl ester,icptes PubChem CID: 90613 IUPAC Name: triethoxy(3-isocyanatopropyl)silane SMILES: CCO[Si](CCCN=C=O)(OCC)OCC
| PubChem CID | 90613 |
|---|---|
| CAS | 24801-88-5 |
| Molecular Weight (g/mol) | 247.366 |
| MDL Number | MFCD00051459 |
| SMILES | CCO[Si](CCCN=C=O)(OCC)OCC |
| Synonym | 3-isocyanatopropyltriethoxysilane,triethoxy 3-isocyanatopropyl silane,3-isocyanatopropyl triethoxysilane,isocyanatopropyltriethoxysilane,3-triethoxysilyl propyl isocyanate,silane, triethoxy 3-isocyanatopropyl,unii-9br6002p6e,isocyanic acid, 3-triethoxysilyl propylester,isocyanic acid, 3-triethoxysilyl propyl ester,icptes |
| IUPAC Name | triethoxy(3-isocyanatopropyl)silane |
| InChI Key | FRGPKMWIYVTFIQ-UHFFFAOYSA-N |
| Molecular Formula | C10H21NO4Si |
(3-Cyanopropyl)trichlorosilane, 98%
CAS: 1071-27-8 Molecular Formula: C4H6Cl3NSi Molecular Weight (g/mol): 202.534 MDL Number: MFCD00013832 InChI Key: HMFFOEBLYHLRQN-UHFFFAOYSA-N Synonym: 3-cyanopropyltrichlorosilane,butanenitrile, 4-trichlorosilyl,4-trichlorosilyl butyronitrile,4-cyanobutyltrichlorosilane,butyronitrile, 4-trichlorosilyl,trichloro 3-cyanopropyl silane,trichlor-3-kyanpropylsilan,silane, trichloro 3-cyanopropyl,unii-05m8iu15r8,gamma-cyanopropyltrichlorosilane PubChem CID: 14063 IUPAC Name: 4-trichlorosilylbutanenitrile SMILES: C(CC#N)C[Si](Cl)(Cl)Cl
| PubChem CID | 14063 |
|---|---|
| CAS | 1071-27-8 |
| Molecular Weight (g/mol) | 202.534 |
| MDL Number | MFCD00013832 |
| SMILES | C(CC#N)C[Si](Cl)(Cl)Cl |
| Synonym | 3-cyanopropyltrichlorosilane,butanenitrile, 4-trichlorosilyl,4-trichlorosilyl butyronitrile,4-cyanobutyltrichlorosilane,butyronitrile, 4-trichlorosilyl,trichloro 3-cyanopropyl silane,trichlor-3-kyanpropylsilan,silane, trichloro 3-cyanopropyl,unii-05m8iu15r8,gamma-cyanopropyltrichlorosilane |
| IUPAC Name | 4-trichlorosilylbutanenitrile |
| InChI Key | HMFFOEBLYHLRQN-UHFFFAOYSA-N |
| Molecular Formula | C4H6Cl3NSi |
Chlorotriphenylsilane, 96%
CAS: 76-86-8 Molecular Formula: C18H15ClSi Molecular Weight (g/mol): 294.85 MDL Number: MFCD00000496 InChI Key: MNKYQPOFRKPUAE-UHFFFAOYSA-N Synonym: triphenylsilyl chloride,triphenylchlorosilane,silane, chlorotriphenyl,triphenylsilicon chloride,chloro triphenyl silane,triphenylsilylchloride,chloro-tri phenyl silane,benzene, 1,1',1-chlorosilylidyne tris,clsiph3,ph3sicl PubChem CID: 6458 IUPAC Name: chloro(triphenyl)silane SMILES: Cl[Si](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 6458 |
|---|---|
| CAS | 76-86-8 |
| Molecular Weight (g/mol) | 294.85 |
| MDL Number | MFCD00000496 |
| SMILES | Cl[Si](C1=CC=CC=C1)(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | triphenylsilyl chloride,triphenylchlorosilane,silane, chlorotriphenyl,triphenylsilicon chloride,chloro triphenyl silane,triphenylsilylchloride,chloro-tri phenyl silane,benzene, 1,1',1-chlorosilylidyne tris,clsiph3,ph3sicl |
| IUPAC Name | chloro(triphenyl)silane |
| InChI Key | MNKYQPOFRKPUAE-UHFFFAOYSA-N |
| Molecular Formula | C18H15ClSi |
1-(Trimethylsiloxy)cyclohexene, 98%
CAS: 6651-36-1 Molecular Formula: C9H18OSi Molecular Weight (g/mol): 170.33 MDL Number: MFCD00001541 InChI Key: SBEMOANGDSSPJY-UHFFFAOYSA-N Synonym: 1-trimethylsilyloxy cyclohexene,cyclohex-1-en-1-yloxy trimethylsilane,1-trimethylsiloxy cyclohexene,silane, 1-cyclohexen-1-yloxy trimethyl,1-cyclohexenyloxytrimethylsilane,1-cyclohexen-1-yloxy trimethylsilane,cyclohexene, 1-trimethylsilyl oxy,cyclohexenyloxy trimethylsilane,1-trimethylsiloxycyclohexene,cyclohexenyloxytrimethylsilane PubChem CID: 81161 IUPAC Name: cyclohexen-1-yloxy(trimethyl)silane SMILES: C[Si](C)(C)OC1=CCCCC1
| PubChem CID | 81161 |
|---|---|
| CAS | 6651-36-1 |
| Molecular Weight (g/mol) | 170.33 |
| MDL Number | MFCD00001541 |
| SMILES | C[Si](C)(C)OC1=CCCCC1 |
| Synonym | 1-trimethylsilyloxy cyclohexene,cyclohex-1-en-1-yloxy trimethylsilane,1-trimethylsiloxy cyclohexene,silane, 1-cyclohexen-1-yloxy trimethyl,1-cyclohexenyloxytrimethylsilane,1-cyclohexen-1-yloxy trimethylsilane,cyclohexene, 1-trimethylsilyl oxy,cyclohexenyloxy trimethylsilane,1-trimethylsiloxycyclohexene,cyclohexenyloxytrimethylsilane |
| IUPAC Name | cyclohexen-1-yloxy(trimethyl)silane |
| InChI Key | SBEMOANGDSSPJY-UHFFFAOYSA-N |
| Molecular Formula | C9H18OSi |
3-(2-Aminoethylamino)propyltrimethoxysilane, 96%
CAS: 1760-24-3 Molecular Formula: C8H22N2O3Si Molecular Weight (g/mol): 222.36 MDL Number: MFCD00008173 InChI Key: PHQOGHDTIVQXHL-UHFFFAOYSA-N Synonym: n-3-trimethoxysilyl propyl ethylenediamine,n-2-aminoethyl-3-aminopropyltrimethoxysilane,3-2-aminoethylamino propyltrimethoxysilane,en-aptas,silicone a-1120,prosil 3128,aas-m,n1-3-trimethoxysilyl propyl ethane-1,2-diamine,unii-28zcs5ga8g,3-2-aminoethyl aminopropyl trimethoxysilane PubChem CID: 15659 IUPAC Name: N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine SMILES: CO[Si](CCCNCCN)(OC)OC
| PubChem CID | 15659 |
|---|---|
| CAS | 1760-24-3 |
| Molecular Weight (g/mol) | 222.36 |
| MDL Number | MFCD00008173 |
| SMILES | CO[Si](CCCNCCN)(OC)OC |
| Synonym | n-3-trimethoxysilyl propyl ethylenediamine,n-2-aminoethyl-3-aminopropyltrimethoxysilane,3-2-aminoethylamino propyltrimethoxysilane,en-aptas,silicone a-1120,prosil 3128,aas-m,n1-3-trimethoxysilyl propyl ethane-1,2-diamine,unii-28zcs5ga8g,3-2-aminoethyl aminopropyl trimethoxysilane |
| IUPAC Name | N'-(3-trimethoxysilylpropyl)ethane-1,2-diamine |
| InChI Key | PHQOGHDTIVQXHL-UHFFFAOYSA-N |
| Molecular Formula | C8H22N2O3Si |
Lithium tetrakis(pentafluorophenyl)borate ethyl etherate
CAS: 371162-53-7 Molecular Formula: 2·5 C4H10O Molecular Weight (g/mol): 871.28 InChI Key: KPLZKJQZPFREPG-UHFFFAOYSA-N Synonym: lithium tetrakis pentafluorophenyl borate ethyl etherate,lithium tetrakis pentafluorophenyl borate,tetrakis pentafluorophenyl boron lithium ethyl etherate,lithium tetrakis pentafluorophenyl borate-ethyl ether complex,lithium tetrakis pentafluorophenyl borate ethyl etherate 2:2:5,lithium tetrakis pentafluorophenyl borate diethylether complex 1:2.5 PubChem CID: 23701484 IUPAC Name: lithium;ethoxyethane;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide SMILES: [Li+].[B-](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F.CCOCC
| PubChem CID | 23701484 |
|---|---|
| CAS | 371162-53-7 |
| Molecular Weight (g/mol) | 871.28 |
| SMILES | [Li+].[B-](C1=C(C(=C(C(=C1F)F)F)F)F)(C2=C(C(=C(C(=C2F)F)F)F)F)(C3=C(C(=C(C(=C3F)F)F)F)F)C4=C(C(=C(C(=C4F)F)F)F)F.CCOCC |
| Synonym | lithium tetrakis pentafluorophenyl borate ethyl etherate,lithium tetrakis pentafluorophenyl borate,tetrakis pentafluorophenyl boron lithium ethyl etherate,lithium tetrakis pentafluorophenyl borate-ethyl ether complex,lithium tetrakis pentafluorophenyl borate ethyl etherate 2:2:5,lithium tetrakis pentafluorophenyl borate diethylether complex 1:2.5 |
| IUPAC Name | lithium;ethoxyethane;tetrakis(2,3,4,5,6-pentafluorophenyl)boranuide |
| InChI Key | KPLZKJQZPFREPG-UHFFFAOYSA-N |
| Molecular Formula | 2·5 C4H10O |
Allyltrimethylsilane, 98+%
CAS: 762-72-1 Molecular Formula: C6H14Si Molecular Weight (g/mol): 114.263 MDL Number: MFCD00008635 InChI Key: HYWCXWRMUZYRPH-UHFFFAOYSA-N Synonym: allyltrimethylsilane,silane, trimethyl-2-propenyl,trimethylallylsilane,silane, allyltrimethyl,allyl trimethylsilane,unii-8b84c337vf,ccris 2649,allyl trimethyl silane,3-trimethylsilyl propene,allytrimethylsilane PubChem CID: 69808 IUPAC Name: trimethyl(prop-2-enyl)silane SMILES: C[Si](C)(C)CC=C
| PubChem CID | 69808 |
|---|---|
| CAS | 762-72-1 |
| Molecular Weight (g/mol) | 114.263 |
| MDL Number | MFCD00008635 |
| SMILES | C[Si](C)(C)CC=C |
| Synonym | allyltrimethylsilane,silane, trimethyl-2-propenyl,trimethylallylsilane,silane, allyltrimethyl,allyl trimethylsilane,unii-8b84c337vf,ccris 2649,allyl trimethyl silane,3-trimethylsilyl propene,allytrimethylsilane |
| IUPAC Name | trimethyl(prop-2-enyl)silane |
| InChI Key | HYWCXWRMUZYRPH-UHFFFAOYSA-N |
| Molecular Formula | C6H14Si |
Methyltrimethoxysilane, 97%
CAS: 1185-55-3 Molecular Formula: C4H12O3Si Molecular Weight (g/mol): 136.222 MDL Number: MFCD00008342 InChI Key: BFXIKLCIZHOAAZ-UHFFFAOYSA-N Synonym: methyltrimethoxysilane,trimethoxy methyl silane,silane, trimethoxymethyl,union carbide a-163,silane, methyltrimethoxy,methyl trimethoxysilane,silane a-163,dynasylan mtms,unii-0hi0d71mci,methyl-trimethoxysilane PubChem CID: 14456 IUPAC Name: trimethoxy(methyl)silane SMILES: CO[Si](C)(OC)OC
| PubChem CID | 14456 |
|---|---|
| CAS | 1185-55-3 |
| Molecular Weight (g/mol) | 136.222 |
| MDL Number | MFCD00008342 |
| SMILES | CO[Si](C)(OC)OC |
| Synonym | methyltrimethoxysilane,trimethoxy methyl silane,silane, trimethoxymethyl,union carbide a-163,silane, methyltrimethoxy,methyl trimethoxysilane,silane a-163,dynasylan mtms,unii-0hi0d71mci,methyl-trimethoxysilane |
| IUPAC Name | trimethoxy(methyl)silane |
| InChI Key | BFXIKLCIZHOAAZ-UHFFFAOYSA-N |
| Molecular Formula | C4H12O3Si |
Bis(trimethylsilyl)methane, 98%
CAS: 2117-28-4 Molecular Formula: C7H20Si2 Molecular Weight (g/mol): 160.41 MDL Number: MFCD00008275 InChI Key: GYIODRUWWNNGPI-UHFFFAOYSA-N Synonym: bis trimethylsilyl methane,methylenebis trimethylsilane,silane, methylenebis trimethyl,trimethyl trimethylsilylmethyl silane,trimethyl trimethylsilyl methyl silane,2,4-disilapentane, 2,2,4,4-tetramethyl,silane, 1,1'-methylenebis 1,1,1-trimethyl PubChem CID: 75029 IUPAC Name: trimethyl(trimethylsilylmethyl)silane SMILES: C[Si](C)(C)C[Si](C)(C)C
| PubChem CID | 75029 |
|---|---|
| CAS | 2117-28-4 |
| Molecular Weight (g/mol) | 160.41 |
| MDL Number | MFCD00008275 |
| SMILES | C[Si](C)(C)C[Si](C)(C)C |
| Synonym | bis trimethylsilyl methane,methylenebis trimethylsilane,silane, methylenebis trimethyl,trimethyl trimethylsilylmethyl silane,trimethyl trimethylsilyl methyl silane,2,4-disilapentane, 2,2,4,4-tetramethyl,silane, 1,1'-methylenebis 1,1,1-trimethyl |
| IUPAC Name | trimethyl(trimethylsilylmethyl)silane |
| InChI Key | GYIODRUWWNNGPI-UHFFFAOYSA-N |
| Molecular Formula | C7H20Si2 |